C5HCl3F8O — CID 175726700
1,1,1,2,2,3,3-heptafluoro-3-(1,1,2-trichloro-2-fluoroethoxy)propane (PubChem CID 175726700) has the molecular formula C5HCl3F8O and a molecular weight of 335.41 g/mol. Its IUPAC name is 1,1,1,2,2,3,3-heptafluoro-3-(1,1,2-trichloro-2-fluoroethoxy)propane.
| Compound Name | 1,1,1,2,2,3,3-heptafluoro-3-(1,1,2-trichloro-2-fluoroethoxy)propane |
|---|---|
| PubChem CID | 175726700 |
| Molecular Formula | C5HCl3F8O |
| Molecular Weight | 335.41 g/mol |
| Exact Mass | 333.90 |
| IUPAC Name | 1,1,1,2,2,3,3-heptafluoro-3-(1,1,2-trichloro-2-fluoroethoxy)propane |
| SMILES | FC(Cl)C(Cl)(Cl)OC(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C5HCl3F8O/c6-1(9)2(7,8)17-5(15,16)3(10,11)4(12,13)14/h1H |
| InChIKey | KRLGVZRUZIAXBB-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.41 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|