C14HF29O4 — CID 99717314
(2R)-1,1,1,2,3,3-hexafluoro-2-[(2S)-1,1,2,3,3,3-hexafluoro-2-[(2S)-1,1,2,3,3,3-hexafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)propoxy]propoxy]-3-[(1S)-1,2,2,2-tetrafluoroethoxy]propane (PubChem CID 99717314) has the molecular formula C14HF29O4 and a molecular weight of 784.10 g/mol. Its IUPAC name is (2R)-1,1,1,2,3,3-hexafluoro-2-[(2S)-1,1,2,3,3,3-hexafluoro-2-[(2S)-1,1,2,3,3,3-hexafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)propoxy]propoxy]-3-[(1S)-1,2,2,2-tetrafluoroethoxy]propane.
| Compound Name | (2R)-1,1,1,2,3,3-hexafluoro-2-[(2S)-1,1,2,3,3,3-hexafluoro-2-[(2S)-1,1,2,3,3,3-hexafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)propoxy]propoxy]-3-[(1S)-1,2,2,2-tetrafluoroethoxy]propane |
|---|---|
| PubChem CID | 99717314 |
| Molecular Formula | C14HF29O4 |
| Molecular Weight | 784.10 g/mol |
| Exact Mass | 783.94 |
| IUPAC Name | (2R)-1,1,1,2,3,3-hexafluoro-2-[(2S)-1,1,2,3,3,3-hexafluoro-2-[(2S)-1,1,2,3,3,3-hexafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)propoxy]propoxy]-3-[(1S)-1,2,2,2-tetrafluoroethoxy]propane |
| SMILES | F[C@H](OC(F)(F)[C@](F)(OC(F)(F)[C@@](F)(OC(F)(F)[C@@](F)(OC(F)(F)C(F)(F)C(F)(F)F)C(F)(F)F)C(F)(F)F)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C14HF29O4/c15-1(2(16,17)18)44-12(38,39)4(21,8(27,28)29)46-14(42,43)6(23,10(33,34)35)47-13(40,41)5(22,9(30,31)32)45-11(36,37)3(19,20)7(24,25)26/h1H/t1-,4-,5+,6+/m1/s1 |
| InChIKey | NOCLWIPRQIWFMR-XXSLJMRWSA-N |
| XLogP | 9.16 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 784.10 |
| LogP ≤ 5 | 9.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|