C28H14F32O10 — CID 89361975
diethyl 2,5-bis[1,1,2-trifluoro-2-[1,1,2,3,3,3-hexafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)propoxy]ethoxy]benzene-1,4-dicarboxylate (PubChem CID 89361975) has the molecular formula C28H14F32O10 and a molecular weight of 1118.35 g/mol. Its IUPAC name is diethyl 2,5-bis[1,1,2-trifluoro-2-[1,1,2,3,3,3-hexafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)propoxy]ethoxy]benzene-1,4-dicarboxylate.
| Compound Name | diethyl 2,5-bis[1,1,2-trifluoro-2-[1,1,2,3,3,3-hexafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)propoxy]ethoxy]benzene-1,4-dicarboxylate |
|---|---|
| PubChem CID | 89361975 |
| Molecular Formula | C28H14F32O10 |
| Molecular Weight | 1118.35 g/mol |
| Exact Mass | 1118.01 |
| IUPAC Name | diethyl 2,5-bis[1,1,2-trifluoro-2-[1,1,2,3,3,3-hexafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)propoxy]ethoxy]benzene-1,4-dicarboxylate |
| SMILES | CCOC(=O)c1cc(OC(F)(F)C(F)OC(F)(F)C(F)(OC(F)(F)C(F)(F)C(F)(F)F)C(F)(F)F)c(C(=O)OCC)cc1OC(F)(F)C(F)OC(F)(F)C(F)(OC(F)(F)C(F)(F)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C28H14F32O10/c1-3-63-11(61)7-5-10(66-16(33,34)14(30)68-28(59,60)20(40,24(50,51)52)70-26(55,56)18(37,38)22(44,45)46)8(12(62)64-4-2)6-9(7)65-15(31,32)13(29)67-27(57,58)19(39,23(47,48)49)69-25(53,54)17(35,36)21(41,42)43/h5-6,13-14H,3-4H2,1-2H3 |
| InChIKey | VHTCLXQEGXALOH-UHFFFAOYSA-N |
| XLogP | 11.86 |
| TPSA | 107.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 70 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1118.35 |
| LogP ≤ 5 | 11.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|