C13H10F10O4 — CID 90123295
2-[2-[1,1,2-trifluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)ethoxy]phenoxy]ethanol (PubChem CID 90123295) has the molecular formula C13H10F10O4 and a molecular weight of 420.20 g/mol. Its IUPAC name is 2-[2-[1,1,2-trifluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)ethoxy]phenoxy]ethanol.
| Compound Name | 2-[2-[1,1,2-trifluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)ethoxy]phenoxy]ethanol |
|---|---|
| PubChem CID | 90123295 |
| Molecular Formula | C13H10F10O4 |
| Molecular Weight | 420.20 g/mol |
| Exact Mass | 420.04 |
| IUPAC Name | 2-[2-[1,1,2-trifluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)ethoxy]phenoxy]ethanol |
| SMILES | OCCOc1ccccc1OC(F)(F)C(F)OC(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C13H10F10O4/c14-9(27-13(22,23)11(17,18)12(19,20)21)10(15,16)26-8-4-2-1-3-7(8)25-6-5-24/h1-4,9,24H,5-6H2 |
| InChIKey | GXZOZVGVPZQPKD-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.20 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|