C9H6F7NO — CID 139854943
2-(1,1,2,2,3,3,3-heptafluoropropoxy)aniline (PubChem CID 139854943) has the molecular formula C9H6F7NO and a molecular weight of 277.14 g/mol. Its IUPAC name is 2-(1,1,2,2,3,3,3-heptafluoropropoxy)aniline.
| Compound Name | 2-(1,1,2,2,3,3,3-heptafluoropropoxy)aniline |
|---|---|
| PubChem CID | 139854943 |
| Molecular Formula | C9H6F7NO |
| Molecular Weight | 277.14 g/mol |
| Exact Mass | 277.03 |
| IUPAC Name | 2-(1,1,2,2,3,3,3-heptafluoropropoxy)aniline |
| SMILES | Nc1ccccc1OC(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C9H6F7NO/c10-7(11,8(12,13)14)9(15,16)18-6-4-2-1-3-5(6)17/h1-4H,17H2 |
| InChIKey | MQADQVJVNRKNLZ-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.14 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|