C15H11F6NO — CID 174893224
2-(1,2,2,3,3,3-hexafluoro-1-phenoxypropyl)aniline (PubChem CID 174893224) has the molecular formula C15H11F6NO and a molecular weight of 335.25 g/mol. Its IUPAC name is 2-(1,2,2,3,3,3-hexafluoro-1-phenoxypropyl)aniline.
| Compound Name | 2-(1,2,2,3,3,3-hexafluoro-1-phenoxypropyl)aniline |
|---|---|
| PubChem CID | 174893224 |
| Molecular Formula | C15H11F6NO |
| Molecular Weight | 335.25 g/mol |
| Exact Mass | 335.07 |
| IUPAC Name | 2-(1,2,2,3,3,3-hexafluoro-1-phenoxypropyl)aniline |
| SMILES | Nc1ccccc1C(F)(Oc1ccccc1)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C15H11F6NO/c16-13(14(17,18)15(19,20)21,11-8-4-5-9-12(11)22)23-10-6-2-1-3-7-10/h1-9H,22H2 |
| InChIKey | QOIDSDIEXAGIHF-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.25 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|