C10H6F9N — CID 174841503
2-(1,1,1,2,3,3,4,4,4-nonafluorobutan-2-yl)aniline (PubChem CID 174841503) has the molecular formula C10H6F9N and a molecular weight of 311.15 g/mol. Its IUPAC name is 2-(1,1,1,2,3,3,4,4,4-nonafluorobutan-2-yl)aniline.
| Compound Name | 2-(1,1,1,2,3,3,4,4,4-nonafluorobutan-2-yl)aniline |
|---|---|
| PubChem CID | 174841503 |
| Molecular Formula | C10H6F9N |
| Molecular Weight | 311.15 g/mol |
| Exact Mass | 311.04 |
| IUPAC Name | 2-(1,1,1,2,3,3,4,4,4-nonafluorobutan-2-yl)aniline |
| SMILES | Nc1ccccc1C(F)(C(F)(F)F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C10H6F9N/c11-7(9(14,15)16,8(12,13)10(17,18)19)5-3-1-2-4-6(5)20/h1-4H,20H2 |
| InChIKey | OIVBAUGQBYCDEC-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.15 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|