About 1H-indole;2-(trifluoromethyl)aniline
1H-indole;2-(trifluoromethyl)aniline (PubChem CID 158161787) has the molecular formula C15H13F3N2
and a molecular weight of 278.28 g/mol. Its IUPAC name is 1H-indole;2-(trifluoromethyl)aniline.
Molecular Properties
| Compound Name | 1H-indole;2-(trifluoromethyl)aniline |
| PubChem CID | 158161787 |
| Molecular Formula | C15H13F3N2 |
| Molecular Weight | 278.28 g/mol |
| Exact Mass | 278.10 |
| IUPAC Name | 1H-indole;2-(trifluoromethyl)aniline |
| SMILES | Nc1ccccc1C(F)(F)F.c1ccc2[nH]ccc2c1 |
| InChI | InChI=1S/C8H7N.C7H6F3N/c1-2-4-8-7(3-1)5-6-9-8;8-7(9,10)5-3-1-2-4-6(5)11/h1-6,9H;1-4H,11H2 |
| InChIKey | FWIZIFMGBHPPNB-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 41.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.28 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 1H-indole;2-(trifluoromethyl)aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1H-indole;2-(trifluoromethyl)aniline?
The IUPAC name of 1H-indole;2-(trifluoromethyl)aniline (CID 158161787) is 1H-indole;2-(trifluoromethyl)aniline.
What is the SMILES notation for 1H-indole;2-(trifluoromethyl)aniline?
The canonical SMILES for 1H-indole;2-(trifluoromethyl)aniline is Nc1ccccc1C(F)(F)F.c1ccc2[nH]ccc2c1.
What is the InChIKey of 1H-indole;2-(trifluoromethyl)aniline?
The InChIKey is FWIZIFMGBHPPNB-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7N.C7H6F3N/c1-2-4-8-7(3-1)5-6-9-8;8-7(9,10)5-3-1-2-4-6(5)11/h1-6,9H;1-4H,11H2.
What are the key properties of 1H-indole;2-(trifluoromethyl)aniline?
1H-indole;2-(trifluoromethyl)aniline has a molecular weight of 278.28 g/mol, XLogP of 4.46, 0 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1H-indole;2-(trifluoromethyl)aniline is sourced from PubChem (CID 158161787), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).