C9H6F6OS — CID 144882533
1,1,1,3,3,3-hexafluoro-2-phenoxypropane-2-thiol (PubChem CID 144882533) has the molecular formula C9H6F6OS and a molecular weight of 276.20 g/mol. Its IUPAC name is 1,1,1,3,3,3-hexafluoro-2-phenoxypropane-2-thiol.
| Compound Name | 1,1,1,3,3,3-hexafluoro-2-phenoxypropane-2-thiol |
|---|---|
| PubChem CID | 144882533 |
| Molecular Formula | C9H6F6OS |
| Molecular Weight | 276.20 g/mol |
| Exact Mass | 276.00 |
| IUPAC Name | 1,1,1,3,3,3-hexafluoro-2-phenoxypropane-2-thiol |
| SMILES | FC(F)(F)C(S)(Oc1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C9H6F6OS/c10-8(11,12)7(17,9(13,14)15)16-6-4-2-1-3-5-6/h1-5,17H |
| InChIKey | TZFFNYJFTFWMGU-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 9.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.20 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|