C15H12F6N2O — CID 87963054
3-(1,2,2,3,3,3-hexafluoro-1-phenylpropoxy)benzene-1,2-diamine (PubChem CID 87963054) has the molecular formula C15H12F6N2O and a molecular weight of 350.26 g/mol. Its IUPAC name is 3-(1,2,2,3,3,3-hexafluoro-1-phenylpropoxy)benzene-1,2-diamine.
| Compound Name | 3-(1,2,2,3,3,3-hexafluoro-1-phenylpropoxy)benzene-1,2-diamine |
|---|---|
| PubChem CID | 87963054 |
| Molecular Formula | C15H12F6N2O |
| Molecular Weight | 350.26 g/mol |
| Exact Mass | 350.09 |
| IUPAC Name | 3-(1,2,2,3,3,3-hexafluoro-1-phenylpropoxy)benzene-1,2-diamine |
| SMILES | Nc1cccc(OC(F)(c2ccccc2)C(F)(F)C(F)(F)F)c1N |
| InChI | InChI=1S/C15H12F6N2O/c16-13(9-5-2-1-3-6-9,14(17,18)15(19,20)21)24-11-8-4-7-10(22)12(11)23/h1-8H,22-23H2 |
| InChIKey | QXGGMTBHYJZCNB-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 61.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.26 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|