C8H8F4N2O — CID 70379476
3-(1,2,2,2-tetrafluoroethoxy)benzene-1,2-diamine (PubChem CID 70379476) has the molecular formula C8H8F4N2O and a molecular weight of 224.16 g/mol. Its IUPAC name is 3-(1,2,2,2-tetrafluoroethoxy)benzene-1,2-diamine.
| Compound Name | 3-(1,2,2,2-tetrafluoroethoxy)benzene-1,2-diamine |
|---|---|
| PubChem CID | 70379476 |
| Molecular Formula | C8H8F4N2O |
| Molecular Weight | 224.16 g/mol |
| Exact Mass | 224.06 |
| IUPAC Name | 3-(1,2,2,2-tetrafluoroethoxy)benzene-1,2-diamine |
| SMILES | Nc1cccc(OC(F)C(F)(F)F)c1N |
| InChI | InChI=1S/C8H8F4N2O/c9-7(8(10,11)12)15-5-3-1-2-4(13)6(5)14/h1-3,7H,13-14H2 |
| InChIKey | OFJFLDCVXKQRPP-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 61.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.16 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|