About 3-ethoxyaniline
3-ethoxyaniline (PubChem CID 12120) has the molecular formula C8H11NO
and a molecular weight of 137.18 g/mol. Its IUPAC name is 3-ethoxyaniline.
Molecular Properties
| Compound Name | 3-ethoxyaniline |
| PubChem CID | 12120 |
| Molecular Formula | C8H11NO |
| Molecular Weight | 137.18 g/mol |
| Exact Mass | 137.08 |
| IUPAC Name | 3-ethoxyaniline |
| SMILES | CCOc1cccc(N)c1 |
| InChI | InChI=1S/C8H11NO/c1-2-10-8-5-3-4-7(9)6-8/h3-6H,2,9H2,1H3 |
| InChIKey | WEZAHYDFZNTGKE-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 137.18 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 3-ethoxyaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethoxyaniline?
The IUPAC name of 3-ethoxyaniline (CID 12120) is 3-ethoxyaniline.
What is the SMILES notation for 3-ethoxyaniline?
The canonical SMILES for 3-ethoxyaniline is CCOc1cccc(N)c1.
What is the InChIKey of 3-ethoxyaniline?
The InChIKey is WEZAHYDFZNTGKE-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11NO/c1-2-10-8-5-3-4-7(9)6-8/h3-6H,2,9H2,1H3.
What are the key properties of 3-ethoxyaniline?
3-ethoxyaniline has a molecular weight of 137.18 g/mol, XLogP of 1.67, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethoxyaniline is sourced from PubChem (CID 12120), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).