C13H16N4 — CID 54107045
3-[diamino(phenyl)methyl]benzene-1,2-diamine (PubChem CID 54107045) has the molecular formula C13H16N4 and a molecular weight of 228.30 g/mol. Its IUPAC name is 3-[diamino(phenyl)methyl]benzene-1,2-diamine.
| Compound Name | 3-[diamino(phenyl)methyl]benzene-1,2-diamine |
|---|---|
| PubChem CID | 54107045 |
| Molecular Formula | C13H16N4 |
| Molecular Weight | 228.30 g/mol |
| Exact Mass | 228.14 |
| IUPAC Name | 3-[diamino(phenyl)methyl]benzene-1,2-diamine |
| SMILES | Nc1cccc(C(N)(N)c2ccccc2)c1N |
| InChI | InChI=1S/C13H16N4/c14-11-8-4-7-10(12(11)15)13(16,17)9-5-2-1-3-6-9/h1-8H,14-17H2 |
| InChIKey | NELYMGHITMRMLH-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 104.08 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.30 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|