C8H6BrF4NO — CID 87396327
2-(2-bromo-1,1,2,2-tetrafluoroethoxy)aniline (PubChem CID 87396327) has the molecular formula C8H6BrF4NO and a molecular weight of 288.04 g/mol. Its IUPAC name is 2-(2-bromo-1,1,2,2-tetrafluoroethoxy)aniline.
| Compound Name | 2-(2-bromo-1,1,2,2-tetrafluoroethoxy)aniline |
|---|---|
| PubChem CID | 87396327 |
| Molecular Formula | C8H6BrF4NO |
| Molecular Weight | 288.04 g/mol |
| Exact Mass | 286.96 |
| IUPAC Name | 2-(2-bromo-1,1,2,2-tetrafluoroethoxy)aniline |
| SMILES | Nc1ccccc1OC(F)(F)C(F)(F)Br |
| InChI | InChI=1S/C8H6BrF4NO/c9-7(10,11)8(12,13)15-6-4-2-1-3-5(6)14/h1-4H,14H2 |
| InChIKey | MEXDIRZWOLHUIX-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.04 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|