C15H8BrF5O2 — CID 88695083
[2-(2-bromo-1,1,2,2-tetrafluoroethoxy)-4-fluorophenyl]-phenylmethanone (PubChem CID 88695083) has the molecular formula C15H8BrF5O2 and a molecular weight of 395.12 g/mol. Its IUPAC name is [2-(2-bromo-1,1,2,2-tetrafluoroethoxy)-4-fluorophenyl]-phenylmethanone.
| Compound Name | [2-(2-bromo-1,1,2,2-tetrafluoroethoxy)-4-fluorophenyl]-phenylmethanone |
|---|---|
| PubChem CID | 88695083 |
| Molecular Formula | C15H8BrF5O2 |
| Molecular Weight | 395.12 g/mol |
| Exact Mass | 393.96 |
| IUPAC Name | [2-(2-bromo-1,1,2,2-tetrafluoroethoxy)-4-fluorophenyl]-phenylmethanone |
| SMILES | O=C(c1ccccc1)c1ccc(F)cc1OC(F)(F)C(F)(F)Br |
| InChI | InChI=1S/C15H8BrF5O2/c16-14(18,19)15(20,21)23-12-8-10(17)6-7-11(12)13(22)9-4-2-1-3-5-9/h1-8H |
| InChIKey | IZDXDISWMVQOMX-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.12 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|