C15H14O4 — CID 139905658
[2-(1,1-dihydroxyethoxy)phenyl]-phenylmethanone (PubChem CID 139905658) has the molecular formula C15H14O4 and a molecular weight of 258.27 g/mol. Its IUPAC name is [2-(1,1-dihydroxyethoxy)phenyl]-phenylmethanone.
| Compound Name | [2-(1,1-dihydroxyethoxy)phenyl]-phenylmethanone |
|---|---|
| PubChem CID | 139905658 |
| Molecular Formula | C15H14O4 |
| Molecular Weight | 258.27 g/mol |
| Exact Mass | 258.09 |
| IUPAC Name | [2-(1,1-dihydroxyethoxy)phenyl]-phenylmethanone |
| SMILES | CC(O)(O)Oc1ccccc1C(=O)c1ccccc1 |
| InChI | InChI=1S/C15H14O4/c1-15(17,18)19-13-10-6-5-9-12(13)14(16)11-7-3-2-4-8-11/h2-10,17-18H,1H3 |
| InChIKey | PGKGVWDJKKKNEU-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.27 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|