C16H10F6O2 — CID 19821213
[2-(1,1,2,3,3,3-hexafluoropropoxy)phenyl]-phenylmethanone (PubChem CID 19821213) has the molecular formula C16H10F6O2 and a molecular weight of 348.24 g/mol. Its IUPAC name is [2-(1,1,2,3,3,3-hexafluoropropoxy)phenyl]-phenylmethanone.
| Compound Name | [2-(1,1,2,3,3,3-hexafluoropropoxy)phenyl]-phenylmethanone |
|---|---|
| PubChem CID | 19821213 |
| Molecular Formula | C16H10F6O2 |
| Molecular Weight | 348.24 g/mol |
| Exact Mass | 348.06 |
| IUPAC Name | [2-(1,1,2,3,3,3-hexafluoropropoxy)phenyl]-phenylmethanone |
| SMILES | O=C(c1ccccc1)c1ccccc1OC(F)(F)C(F)C(F)(F)F |
| InChI | InChI=1S/C16H10F6O2/c17-14(15(18,19)20)16(21,22)24-12-9-5-4-8-11(12)13(23)10-6-2-1-3-7-10/h1-9,14H |
| InChIKey | FDIUNFSZAYGDHF-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.24 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |