C19H12F2O2 — CID 146007872
(2,4-difluorophenyl)-(4-phenoxyphenyl)methanone (PubChem CID 146007872) has the molecular formula C19H12F2O2 and a molecular weight of 310.30 g/mol. Its IUPAC name is (2,4-difluorophenyl)-(4-phenoxyphenyl)methanone.
| Compound Name | (2,4-difluorophenyl)-(4-phenoxyphenyl)methanone |
|---|---|
| PubChem CID | 146007872 |
| Molecular Formula | C19H12F2O2 |
| Molecular Weight | 310.30 g/mol |
| Exact Mass | 310.08 |
| IUPAC Name | (2,4-difluorophenyl)-(4-phenoxyphenyl)methanone |
| SMILES | O=C(c1ccc(Oc2ccccc2)cc1)c1ccc(F)cc1F |
| InChI | InChI=1S/C19H12F2O2/c20-14-8-11-17(18(21)12-14)19(22)13-6-9-16(10-7-13)23-15-4-2-1-3-5-15/h1-12H |
| InChIKey | JKSJPAFZLZMWIU-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.30 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |