C12H6F10O3 — CID 14618892
4-[1,1,2-trifluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)ethoxy]benzaldehyde (PubChem CID 14618892) has the molecular formula C12H6F10O3 and a molecular weight of 388.16 g/mol. Its IUPAC name is 4-[1,1,2-trifluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)ethoxy]benzaldehyde.
| Compound Name | 4-[1,1,2-trifluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)ethoxy]benzaldehyde |
|---|---|
| PubChem CID | 14618892 |
| Molecular Formula | C12H6F10O3 |
| Molecular Weight | 388.16 g/mol |
| Exact Mass | 388.02 |
| IUPAC Name | 4-[1,1,2-trifluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)ethoxy]benzaldehyde |
| SMILES | O=Cc1ccc(OC(F)(F)C(F)OC(F)(F)C(F)(F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C12H6F10O3/c13-8(25-12(21,22)10(16,17)11(18,19)20)9(14,15)24-7-3-1-6(5-23)2-4-7/h1-5,8H |
| InChIKey | NDNVQZHVTZYTNI-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.16 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|