C12H12ClF3O3 — CID 59543266
ethyl 5-(2-chloro-1,1,2-trifluoroethoxy)-2-methylbenzoate (PubChem CID 59543266) has the molecular formula C12H12ClF3O3 and a molecular weight of 296.67 g/mol. Its IUPAC name is ethyl 5-(2-chloro-1,1,2-trifluoroethoxy)-2-methylbenzoate.
| Compound Name | ethyl 5-(2-chloro-1,1,2-trifluoroethoxy)-2-methylbenzoate |
|---|---|
| PubChem CID | 59543266 |
| Molecular Formula | C12H12ClF3O3 |
| Molecular Weight | 296.67 g/mol |
| Exact Mass | 296.04 |
| IUPAC Name | ethyl 5-(2-chloro-1,1,2-trifluoroethoxy)-2-methylbenzoate |
| SMILES | CCOC(=O)c1cc(OC(F)(F)C(F)Cl)ccc1C |
| InChI | InChI=1S/C12H12ClF3O3/c1-3-18-10(17)9-6-8(5-4-7(9)2)19-12(15,16)11(13)14/h4-6,11H,3H2,1-2H3 |
| InChIKey | KTXCWBQOQDTFJN-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.67 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|