C34H30Cl4CuF12O12+2 — CID 54727832
bis([(E)-1-[2,4-bis(2-chloro-1,1,2-trifluoroethoxy)phenyl]-2-ethoxycarbonyl-3-hydroxybut-2-enylidene]oxidanium);copper (PubChem CID 54727832) has the molecular formula C34H30Cl4CuF12O12+2 and a molecular weight of 1063.94 g/mol. Its IUPAC name is bis([(E)-1-[2,4-bis(2-chloro-1,1,2-trifluoroethoxy)phenyl]-2-ethoxycarbonyl-3-hydroxybut-2-enylidene]oxidanium);copper.
| Compound Name | bis([(E)-1-[2,4-bis(2-chloro-1,1,2-trifluoroethoxy)phenyl]-2-ethoxycarbonyl-3-hydroxybut-2-enylidene]oxidanium);copper |
|---|---|
| PubChem CID | 54727832 |
| Molecular Formula | C34H30Cl4CuF12O12+2 |
| Molecular Weight | 1063.94 g/mol |
| Exact Mass | 1060.96 |
| IUPAC Name | bis([(E)-1-[2,4-bis(2-chloro-1,1,2-trifluoroethoxy)phenyl]-2-ethoxycarbonyl-3-hydroxybut-2-enylidene]oxidanium);copper |
| SMILES | [Cu].[H]/[O+]=C(C(\C(=O)OCC)=C(\C)O)/c1ccc(OC(F)(F)C(F)Cl)cc1OC(F)(F)C(F)Cl.[H]/[O+]=C(C(\C(=O)OCC)=C(\C)O)/c1ccc(OC(F)(F)C(F)Cl)cc1OC(F)(F)C(F)Cl |
| InChI | InChI=1S/2C17H14Cl2F6O6.Cu/c2*1-3-29-13(28)11(7(2)26)12(27)9-5-4-8(30-16(22,23)14(18)20)6-10(9)31-17(24,25)15(19)21;/h2*4-6,14-15,26H,3H2,1-2H3;/p+2/b2*11-7+; |
| InChIKey | XNXFCPLRHDCKHA-NVFNPILPSA-P |
| XLogP | 9.97 |
| TPSA | 172.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1063.94 |
| LogP ≤ 5 | 9.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|