C18H14ClF3N4O3 — CID 14425168
1-[4-(2-chloro-1,1,2-trifluoroethoxy)-2-methylphenyl]-3-(4-phenyl-1,2,5-oxadiazol-3-yl)urea (PubChem CID 14425168) has the molecular formula C18H14ClF3N4O3 and a molecular weight of 426.78 g/mol. Its IUPAC name is 1-[4-(2-chloro-1,1,2-trifluoroethoxy)-2-methylphenyl]-3-(4-phenyl-1,2,5-oxadiazol-3-yl)urea.
| Compound Name | 1-[4-(2-chloro-1,1,2-trifluoroethoxy)-2-methylphenyl]-3-(4-phenyl-1,2,5-oxadiazol-3-yl)urea |
|---|---|
| PubChem CID | 14425168 |
| Molecular Formula | C18H14ClF3N4O3 |
| Molecular Weight | 426.78 g/mol |
| Exact Mass | 426.07 |
| IUPAC Name | 1-[4-(2-chloro-1,1,2-trifluoroethoxy)-2-methylphenyl]-3-(4-phenyl-1,2,5-oxadiazol-3-yl)urea |
| SMILES | Cc1cc(OC(F)(F)C(F)Cl)ccc1NC(=O)Nc1nonc1-c1ccccc1 |
| InChI | InChI=1S/C18H14ClF3N4O3/c1-10-9-12(28-18(21,22)16(19)20)7-8-13(10)23-17(27)24-15-14(25-29-26-15)11-5-3-2-4-6-11/h2-9,16H,1H3,(H2,23,24,26,27) |
| InChIKey | GILZZCOSANAKLA-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 89.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.78 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|