C13H15N3O2 — CID 7678267
3-methyl-N-(4-phenyl-1,2,5-oxadiazol-3-yl)butanamide (PubChem CID 7678267) has the molecular formula C13H15N3O2 and a molecular weight of 245.28 g/mol. Its IUPAC name is 3-methyl-N-(4-phenyl-1,2,5-oxadiazol-3-yl)butanamide.
| Compound Name | 3-methyl-N-(4-phenyl-1,2,5-oxadiazol-3-yl)butanamide |
|---|---|
| PubChem CID | 7678267 |
| Molecular Formula | C13H15N3O2 |
| Molecular Weight | 245.28 g/mol |
| Exact Mass | 245.12 |
| IUPAC Name | 3-methyl-N-(4-phenyl-1,2,5-oxadiazol-3-yl)butanamide |
| SMILES | CC(C)CC(=O)Nc1nonc1-c1ccccc1 |
| InChI | InChI=1S/C13H15N3O2/c1-9(2)8-11(17)14-13-12(15-18-16-13)10-6-4-3-5-7-10/h3-7,9H,8H2,1-2H3,(H,14,16,17) |
| InChIKey | OPWQLJSPEFMLBD-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 68.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.28 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |