C15H11N3O3 — CID 7693375
(E)-3-(furan-2-yl)-N-(4-phenyl-1,2,5-oxadiazol-3-yl)prop-2-enamide (PubChem CID 7693375) has the molecular formula C15H11N3O3 and a molecular weight of 281.27 g/mol. Its IUPAC name is (E)-3-(furan-2-yl)-N-(4-phenyl-1,2,5-oxadiazol-3-yl)prop-2-enamide.
| Compound Name | (E)-3-(furan-2-yl)-N-(4-phenyl-1,2,5-oxadiazol-3-yl)prop-2-enamide |
|---|---|
| PubChem CID | 7693375 |
| Molecular Formula | C15H11N3O3 |
| Molecular Weight | 281.27 g/mol |
| Exact Mass | 281.08 |
| IUPAC Name | (E)-3-(furan-2-yl)-N-(4-phenyl-1,2,5-oxadiazol-3-yl)prop-2-enamide |
| SMILES | O=C(/C=C/c1ccco1)Nc1nonc1-c1ccccc1 |
| InChI | InChI=1S/C15H11N3O3/c19-13(9-8-12-7-4-10-20-12)16-15-14(17-21-18-15)11-5-2-1-3-6-11/h1-10H,(H,16,18,19)/b9-8+ |
| InChIKey | QUSYBAFNPQGTJK-CMDGGOBGSA-N |
| XLogP | 2.98 |
| TPSA | 81.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.27 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|