C10H7Cl2F3O3 — CID 154248299
2-(2-chloro-1,1,2-trifluoroethoxy)-4-methoxybenzoyl chloride (PubChem CID 154248299) has the molecular formula C10H7Cl2F3O3 and a molecular weight of 303.06 g/mol. Its IUPAC name is 2-(2-chloro-1,1,2-trifluoroethoxy)-4-methoxybenzoyl chloride.
| Compound Name | 2-(2-chloro-1,1,2-trifluoroethoxy)-4-methoxybenzoyl chloride |
|---|---|
| PubChem CID | 154248299 |
| Molecular Formula | C10H7Cl2F3O3 |
| Molecular Weight | 303.06 g/mol |
| Exact Mass | 301.97 |
| IUPAC Name | 2-(2-chloro-1,1,2-trifluoroethoxy)-4-methoxybenzoyl chloride |
| SMILES | COc1ccc(C(=O)Cl)c(OC(F)(F)C(F)Cl)c1 |
| InChI | InChI=1S/C10H7Cl2F3O3/c1-17-5-2-3-6(8(11)16)7(4-5)18-10(14,15)9(12)13/h2-4,9H,1H3 |
| InChIKey | HUEPVGWVFDBDQM-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.06 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|