C15H8F22O4 — CID 102446330
2-[1,1,2-trifluoro-2-[1,1,2,3,3,3-hexafluoro-2-[1,1,2,3,3,3-hexafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)propoxy]propoxy]ethyl]oxolane (PubChem CID 102446330) has the molecular formula C15H8F22O4 and a molecular weight of 670.18 g/mol. Its IUPAC name is 2-[1,1,2-trifluoro-2-[1,1,2,3,3,3-hexafluoro-2-[1,1,2,3,3,3-hexafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)propoxy]propoxy]ethyl]oxolane.
| Compound Name | 2-[1,1,2-trifluoro-2-[1,1,2,3,3,3-hexafluoro-2-[1,1,2,3,3,3-hexafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)propoxy]propoxy]ethyl]oxolane |
|---|---|
| PubChem CID | 102446330 |
| Molecular Formula | C15H8F22O4 |
| Molecular Weight | 670.18 g/mol |
| Exact Mass | 670.01 |
| IUPAC Name | 2-[1,1,2-trifluoro-2-[1,1,2,3,3,3-hexafluoro-2-[1,1,2,3,3,3-hexafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)propoxy]propoxy]ethyl]oxolane |
| SMILES | FC(OC(F)(F)C(F)(OC(F)(F)C(F)(OC(F)(F)C(F)(F)C(F)(F)F)C(F)(F)F)C(F)(F)F)C(F)(F)C1CCCO1 |
| InChI | InChI=1S/C15H8F22O4/c16-5(6(17,18)4-2-1-3-38-4)39-14(34,35)8(21,11(26,27)28)41-15(36,37)9(22,12(29,30)31)40-13(32,33)7(19,20)10(23,24)25/h4-5H,1-3H2 |
| InChIKey | RATAVRTVSXZHKK-UHFFFAOYSA-N |
| XLogP | 7.58 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 670.18 |
| LogP ≤ 5 | 7.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|