C16H8F23NO5 — CID 137440891
2,2,3,3,5,5,6,6-octafluoro-4-[1,2,2-trifluoro-2-[5-[1,1,2-trifluoro-2-[1,1,2,2,3,3-hexafluoro-3-(trifluoromethoxy)propoxy]ethyl]-1,4-dioxan-2-yl]ethyl]morpholine (PubChem CID 137440891) has the molecular formula C16H8F23NO5 and a molecular weight of 731.20 g/mol. Its IUPAC name is 2,2,3,3,5,5,6,6-octafluoro-4-[1,2,2-trifluoro-2-[5-[1,1,2-trifluoro-2-[1,1,2,2,3,3-hexafluoro-3-(trifluoromethoxy)propoxy]ethyl]-1,4-dioxan-2-yl]ethyl]morpholine.
| Compound Name | 2,2,3,3,5,5,6,6-octafluoro-4-[1,2,2-trifluoro-2-[5-[1,1,2-trifluoro-2-[1,1,2,2,3,3-hexafluoro-3-(trifluoromethoxy)propoxy]ethyl]-1,4-dioxan-2-yl]ethyl]morpholine |
|---|---|
| PubChem CID | 137440891 |
| Molecular Formula | C16H8F23NO5 |
| Molecular Weight | 731.20 g/mol |
| Exact Mass | 731.00 |
| IUPAC Name | 2,2,3,3,5,5,6,6-octafluoro-4-[1,2,2-trifluoro-2-[5-[1,1,2-trifluoro-2-[1,1,2,2,3,3-hexafluoro-3-(trifluoromethoxy)propoxy]ethyl]-1,4-dioxan-2-yl]ethyl]morpholine |
| SMILES | FC(OC(F)(F)C(F)(F)C(F)(F)OC(F)(F)F)C(F)(F)C1COC(C(F)(F)C(F)N2C(F)(F)C(F)(F)OC(F)(F)C2(F)F)CO1 |
| InChI | InChI=1S/C16H8F23NO5/c17-5(40-10(25,26)14(33,34)44-15(35,36)11(40,27)28)7(19,20)3-1-42-4(2-41-3)8(21,22)6(18)43-12(29,30)9(23,24)13(31,32)45-16(37,38)39/h3-6H,1-2H2 |
| InChIKey | YDSIRCALYXNABF-UHFFFAOYSA-N |
| XLogP | 6.71 |
| TPSA | 49.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 731.20 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|