C7H4F12N2O — CID 139932643
2,2-difluoro-1-[1,1,2,2-tetrafluoro-2-(trifluoromethoxy)ethyl]-3-(trifluoromethyl)imidazolidine (PubChem CID 139932643) has the molecular formula C7H4F12N2O and a molecular weight of 360.10 g/mol. Its IUPAC name is 2,2-difluoro-1-[1,1,2,2-tetrafluoro-2-(trifluoromethoxy)ethyl]-3-(trifluoromethyl)imidazolidine.
| Compound Name | 2,2-difluoro-1-[1,1,2,2-tetrafluoro-2-(trifluoromethoxy)ethyl]-3-(trifluoromethyl)imidazolidine |
|---|---|
| PubChem CID | 139932643 |
| Molecular Formula | C7H4F12N2O |
| Molecular Weight | 360.10 g/mol |
| Exact Mass | 360.01 |
| IUPAC Name | 2,2-difluoro-1-[1,1,2,2-tetrafluoro-2-(trifluoromethoxy)ethyl]-3-(trifluoromethyl)imidazolidine |
| SMILES | FC(F)(F)OC(F)(F)C(F)(F)N1CCN(C(F)(F)F)C1(F)F |
| InChI | InChI=1S/C7H4F12N2O/c8-3(9,4(10,11)22-6(15,16)17)20-1-2-21(5(12,13)14)7(20,18)19/h1-2H2 |
| InChIKey | VRHDSWADMZMGLZ-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.10 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|