C6H2Cl2F10O3 — CID 159201056
1,2-dichloro-1,1,2-trifluoro-2-(trifluoromethoxy)ethane;2,2,4,4-tetrafluoro-1,3-dioxolane (PubChem CID 159201056) has the molecular formula C6H2Cl2F10O3 and a molecular weight of 382.97 g/mol. Its IUPAC name is 1,2-dichloro-1,1,2-trifluoro-2-(trifluoromethoxy)ethane;2,2,4,4-tetrafluoro-1,3-dioxolane.
| Compound Name | 1,2-dichloro-1,1,2-trifluoro-2-(trifluoromethoxy)ethane;2,2,4,4-tetrafluoro-1,3-dioxolane |
|---|---|
| PubChem CID | 159201056 |
| Molecular Formula | C6H2Cl2F10O3 |
| Molecular Weight | 382.97 g/mol |
| Exact Mass | 381.92 |
| IUPAC Name | 1,2-dichloro-1,1,2-trifluoro-2-(trifluoromethoxy)ethane;2,2,4,4-tetrafluoro-1,3-dioxolane |
| SMILES | FC(F)(F)OC(F)(Cl)C(F)(F)Cl.FC1(F)COC(F)(F)O1 |
| InChI | InChI=1S/C3Cl2F6O.C3H2F4O2/c4-1(6,7)2(5,8)12-3(9,10)11;4-2(5)1-8-3(6,7)9-2/h;1H2 |
| InChIKey | KPHIXYDERYVFPI-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.97 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|