C6H5F5O2 — CID 21015219
2-ethenyl-4,4-difluoro-2-(trifluoromethyl)-1,3-dioxolane (PubChem CID 21015219) has the molecular formula C6H5F5O2 and a molecular weight of 204.09 g/mol. Its IUPAC name is 2-ethenyl-4,4-difluoro-2-(trifluoromethyl)-1,3-dioxolane.
| Compound Name | 2-ethenyl-4,4-difluoro-2-(trifluoromethyl)-1,3-dioxolane |
|---|---|
| PubChem CID | 21015219 |
| Molecular Formula | C6H5F5O2 |
| Molecular Weight | 204.09 g/mol |
| Exact Mass | 204.02 |
| IUPAC Name | 2-ethenyl-4,4-difluoro-2-(trifluoromethyl)-1,3-dioxolane |
| SMILES | C=CC1(C(F)(F)F)OCC(F)(F)O1 |
| InChI | InChI=1S/C6H5F5O2/c1-2-4(6(9,10)11)12-3-5(7,8)13-4/h2H,1,3H2 |
| InChIKey | DSLABCMZWUJRLE-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.09 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|