C3Cl4F4O — CID 15700925
1,1,2,2-tetrachloro-1-fluoro-2-(trifluoromethoxy)ethane (PubChem CID 15700925) has the molecular formula C3Cl4F4O and a molecular weight of 269.84 g/mol. Its IUPAC name is 1,1,2,2-tetrachloro-1-fluoro-2-(trifluoromethoxy)ethane.
| Compound Name | 1,1,2,2-tetrachloro-1-fluoro-2-(trifluoromethoxy)ethane |
|---|---|
| PubChem CID | 15700925 |
| Molecular Formula | C3Cl4F4O |
| Molecular Weight | 269.84 g/mol |
| Exact Mass | 267.86 |
| IUPAC Name | 1,1,2,2-tetrachloro-1-fluoro-2-(trifluoromethoxy)ethane |
| SMILES | FC(F)(F)OC(Cl)(Cl)C(F)(Cl)Cl |
| InChI | InChI=1S/C3Cl4F4O/c4-1(5,8)2(6,7)12-3(9,10)11 |
| InChIKey | PFZXMFHYUMSBDY-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.84 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|