C5F12O3 — CID 140581421
1,1,1-trifluoro-2,2,2-tris(trifluoromethoxy)ethane (PubChem CID 140581421) has the molecular formula C5F12O3 and a molecular weight of 336.03 g/mol. Its IUPAC name is 1,1,1-trifluoro-2,2,2-tris(trifluoromethoxy)ethane.
| Compound Name | 1,1,1-trifluoro-2,2,2-tris(trifluoromethoxy)ethane |
|---|---|
| PubChem CID | 140581421 |
| Molecular Formula | C5F12O3 |
| Molecular Weight | 336.03 g/mol |
| Exact Mass | 335.97 |
| IUPAC Name | 1,1,1-trifluoro-2,2,2-tris(trifluoromethoxy)ethane |
| SMILES | FC(F)(F)OC(OC(F)(F)F)(OC(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C5F12O3/c6-1(7,8)2(18-3(9,10)11,19-4(12,13)14)20-5(15,16)17 |
| InChIKey | GJSBTHWSJNRPEV-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.03 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|