C3HBrF6O — CID 51439994
(1R)-1-bromo-1,2,2-trifluoro-1-(trifluoromethoxy)ethane (PubChem CID 51439994) has the molecular formula C3HBrF6O and a molecular weight of 246.93 g/mol. Its IUPAC name is (1R)-1-bromo-1,2,2-trifluoro-1-(trifluoromethoxy)ethane.
| Compound Name | (1R)-1-bromo-1,2,2-trifluoro-1-(trifluoromethoxy)ethane |
|---|---|
| PubChem CID | 51439994 |
| Molecular Formula | C3HBrF6O |
| Molecular Weight | 246.93 g/mol |
| Exact Mass | 245.91 |
| IUPAC Name | (1R)-1-bromo-1,2,2-trifluoro-1-(trifluoromethoxy)ethane |
| SMILES | FC(F)[C@@](F)(Br)OC(F)(F)F |
| InChI | InChI=1S/C3HBrF6O/c4-2(7,1(5)6)11-3(8,9)10/h1H/t2-/m0/s1 |
| InChIKey | AWOMFEUKFYXKCV-REOHCLBHSA-N |
| XLogP | 2.81 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.93 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|