C5HF11O — CID 12663045
1,1,1,2,3,3,3-heptafluoro-2-(1,1,2,2-tetrafluoroethoxy)propane (PubChem CID 12663045) has the molecular formula C5HF11O and a molecular weight of 286.04 g/mol. Its IUPAC name is 1,1,1,2,3,3,3-heptafluoro-2-(1,1,2,2-tetrafluoroethoxy)propane.
| Compound Name | 1,1,1,2,3,3,3-heptafluoro-2-(1,1,2,2-tetrafluoroethoxy)propane |
|---|---|
| PubChem CID | 12663045 |
| Molecular Formula | C5HF11O |
| Molecular Weight | 286.04 g/mol |
| Exact Mass | 285.99 |
| IUPAC Name | 1,1,1,2,3,3,3-heptafluoro-2-(1,1,2,2-tetrafluoroethoxy)propane |
| SMILES | FC(F)C(F)(F)OC(F)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C5HF11O/c6-1(7)2(8,9)17-3(10,4(11,12)13)5(14,15)16/h1H |
| InChIKey | CXLGWAAUXKLLRD-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.04 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|