C8H14F4O — CID 139669685
2,3-dimethyl-2-(1,1,2,2-tetrafluoroethoxy)butane (PubChem CID 139669685) has the molecular formula C8H14F4O and a molecular weight of 202.19 g/mol. Its IUPAC name is 2,3-dimethyl-2-(1,1,2,2-tetrafluoroethoxy)butane.
| Compound Name | 2,3-dimethyl-2-(1,1,2,2-tetrafluoroethoxy)butane |
|---|---|
| PubChem CID | 139669685 |
| Molecular Formula | C8H14F4O |
| Molecular Weight | 202.19 g/mol |
| Exact Mass | 202.10 |
| IUPAC Name | 2,3-dimethyl-2-(1,1,2,2-tetrafluoroethoxy)butane |
| SMILES | CC(C)C(C)(C)OC(F)(F)C(F)F |
| InChI | InChI=1S/C8H14F4O/c1-5(2)7(3,4)13-8(11,12)6(9)10/h5-6H,1-4H3 |
| InChIKey | MDTKWBZVXINNBG-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.19 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|