C8H10F8O3 — CID 162232328
1,1,2,2-tetrafluoro-1-[1-(2-fluoroethoxy)-1-(2,2,2-trifluoroethoxy)ethoxy]ethane (PubChem CID 162232328) has the molecular formula C8H10F8O3 and a molecular weight of 306.15 g/mol. Its IUPAC name is 1,1,2,2-tetrafluoro-1-[1-(2-fluoroethoxy)-1-(2,2,2-trifluoroethoxy)ethoxy]ethane.
| Compound Name | 1,1,2,2-tetrafluoro-1-[1-(2-fluoroethoxy)-1-(2,2,2-trifluoroethoxy)ethoxy]ethane |
|---|---|
| PubChem CID | 162232328 |
| Molecular Formula | C8H10F8O3 |
| Molecular Weight | 306.15 g/mol |
| Exact Mass | 306.05 |
| IUPAC Name | 1,1,2,2-tetrafluoro-1-[1-(2-fluoroethoxy)-1-(2,2,2-trifluoroethoxy)ethoxy]ethane |
| SMILES | CC(OCCF)(OCC(F)(F)F)OC(F)(F)C(F)F |
| InChI | InChI=1S/C8H10F8O3/c1-6(17-3-2-9,18-4-7(12,13)14)19-8(15,16)5(10)11/h5H,2-4H2,1H3 |
| InChIKey | ZVPCDSNOUJMQPT-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.15 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|