C13H12F16O4 — CID 15155951
1,3-bis(1,1,2,2-tetrafluoroethoxy)-2,2-bis(1,1,2,2-tetrafluoroethoxymethyl)propane (PubChem CID 15155951) has the molecular formula C13H12F16O4 and a molecular weight of 536.20 g/mol. Its IUPAC name is 1,3-bis(1,1,2,2-tetrafluoroethoxy)-2,2-bis(1,1,2,2-tetrafluoroethoxymethyl)propane.
| Compound Name | 1,3-bis(1,1,2,2-tetrafluoroethoxy)-2,2-bis(1,1,2,2-tetrafluoroethoxymethyl)propane |
|---|---|
| PubChem CID | 15155951 |
| Molecular Formula | C13H12F16O4 |
| Molecular Weight | 536.20 g/mol |
| Exact Mass | 536.05 |
| IUPAC Name | 1,3-bis(1,1,2,2-tetrafluoroethoxy)-2,2-bis(1,1,2,2-tetrafluoroethoxymethyl)propane |
| SMILES | FC(F)C(F)(F)OCC(COC(F)(F)C(F)F)(COC(F)(F)C(F)F)COC(F)(F)C(F)F |
| InChI | InChI=1S/C13H12F16O4/c14-5(15)10(22,23)30-1-9(2-31-11(24,25)6(16)17,3-32-12(26,27)7(18)19)4-33-13(28,29)8(20)21/h5-8H,1-4H2 |
| InChIKey | QJSNTWXSADIJLN-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.20 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|