C8H12F4O4 — CID 139989474
1-(oxiran-2-ylmethoxy)-3-(1,1,2,2-tetrafluoroethoxy)propan-2-ol (PubChem CID 139989474) has the molecular formula C8H12F4O4 and a molecular weight of 248.17 g/mol. Its IUPAC name is 1-(oxiran-2-ylmethoxy)-3-(1,1,2,2-tetrafluoroethoxy)propan-2-ol.
| Compound Name | 1-(oxiran-2-ylmethoxy)-3-(1,1,2,2-tetrafluoroethoxy)propan-2-ol |
|---|---|
| PubChem CID | 139989474 |
| Molecular Formula | C8H12F4O4 |
| Molecular Weight | 248.17 g/mol |
| Exact Mass | 248.07 |
| IUPAC Name | 1-(oxiran-2-ylmethoxy)-3-(1,1,2,2-tetrafluoroethoxy)propan-2-ol |
| SMILES | OC(COCC1CO1)COC(F)(F)C(F)F |
| InChI | InChI=1S/C8H12F4O4/c9-7(10)8(11,12)16-2-5(13)1-14-3-6-4-15-6/h5-7,13H,1-4H2 |
| InChIKey | UQNQBKFDCCCFSU-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.17 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|