C24H48O7 — CID 158042815
cyclohexane;1-[2,2-dimethyl-3-(oxiran-2-ylmethoxy)propoxy]-3-ethoxypropan-2-ol;2-(ethoxymethyl)oxirane (PubChem CID 158042815) has the molecular formula C24H48O7 and a molecular weight of 448.64 g/mol. Its IUPAC name is cyclohexane;1-[2,2-dimethyl-3-(oxiran-2-ylmethoxy)propoxy]-3-ethoxypropan-2-ol;2-(ethoxymethyl)oxirane.
| Compound Name | cyclohexane;1-[2,2-dimethyl-3-(oxiran-2-ylmethoxy)propoxy]-3-ethoxypropan-2-ol;2-(ethoxymethyl)oxirane |
|---|---|
| PubChem CID | 158042815 |
| Molecular Formula | C24H48O7 |
| Molecular Weight | 448.64 g/mol |
| Exact Mass | 448.34 |
| IUPAC Name | cyclohexane;1-[2,2-dimethyl-3-(oxiran-2-ylmethoxy)propoxy]-3-ethoxypropan-2-ol;2-(ethoxymethyl)oxirane |
| SMILES | C1CCCCC1.CCOCC(O)COCC(C)(C)COCC1CO1.CCOCC1CO1 |
| InChI | InChI=1S/C13H26O5.C6H12.C5H10O2/c1-4-15-5-11(14)6-16-9-13(2,3)10-17-7-12-8-18-12;1-2-4-6-5-3-1;1-2-6-3-5-4-7-5/h11-12,14H,4-10H2,1-3H3;1-6H2;5H,2-4H2,1H3 |
| InChIKey | FIOCCXZSSJGDBE-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 82.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.64 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|