C11H26N2O6 — CID 142384045
1-aminooxy-3-[3-(3-aminooxy-2-hydroxypropoxy)-2,2-dimethylpropoxy]propan-2-ol (PubChem CID 142384045) has the molecular formula C11H26N2O6 and a molecular weight of 282.34 g/mol. Its IUPAC name is 1-aminooxy-3-[3-(3-aminooxy-2-hydroxypropoxy)-2,2-dimethylpropoxy]propan-2-ol.
| Compound Name | 1-aminooxy-3-[3-(3-aminooxy-2-hydroxypropoxy)-2,2-dimethylpropoxy]propan-2-ol |
|---|---|
| PubChem CID | 142384045 |
| Molecular Formula | C11H26N2O6 |
| Molecular Weight | 282.34 g/mol |
| Exact Mass | 282.18 |
| IUPAC Name | 1-aminooxy-3-[3-(3-aminooxy-2-hydroxypropoxy)-2,2-dimethylpropoxy]propan-2-ol |
| SMILES | CC(C)(COCC(O)CON)COCC(O)CON |
| InChI | InChI=1S/C11H26N2O6/c1-11(2,7-16-3-9(14)5-18-12)8-17-4-10(15)6-19-13/h9-10,14-15H,3-8,12-13H2,1-2H3 |
| InChIKey | CLPFSDWCFGLVKV-UHFFFAOYSA-N |
| XLogP | -1.45 |
| TPSA | 129.42 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.34 |
| LogP ≤ 5 | -1.45 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|