C14H26O7 — CID 118461097
2-methoxy-1-[2-methyl-3-(oxiran-2-ylmethoxy)-2-(oxiran-2-ylmethoxymethyl)propoxy]ethanol (PubChem CID 118461097) has the molecular formula C14H26O7 and a molecular weight of 306.36 g/mol. Its IUPAC name is 2-methoxy-1-[2-methyl-3-(oxiran-2-ylmethoxy)-2-(oxiran-2-ylmethoxymethyl)propoxy]ethanol.
| Compound Name | 2-methoxy-1-[2-methyl-3-(oxiran-2-ylmethoxy)-2-(oxiran-2-ylmethoxymethyl)propoxy]ethanol |
|---|---|
| PubChem CID | 118461097 |
| Molecular Formula | C14H26O7 |
| Molecular Weight | 306.36 g/mol |
| Exact Mass | 306.17 |
| IUPAC Name | 2-methoxy-1-[2-methyl-3-(oxiran-2-ylmethoxy)-2-(oxiran-2-ylmethoxymethyl)propoxy]ethanol |
| SMILES | COCC(O)OCC(C)(COCC1CO1)COCC1CO1 |
| InChI | InChI=1S/C14H26O7/c1-14(8-17-3-11-5-19-11,9-18-4-12-6-20-12)10-21-13(15)7-16-2/h11-13,15H,3-10H2,1-2H3 |
| InChIKey | MAGBYHMCZQCNPV-UHFFFAOYSA-N |
| XLogP | -0.20 |
| TPSA | 82.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.36 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|