C11H18O6 — CID 142337917
2-methyl-3-(oxiran-2-ylmethoxy)-2-(oxiran-2-ylmethoxymethyl)propanoic acid (PubChem CID 142337917) has the molecular formula C11H18O6 and a molecular weight of 246.26 g/mol. Its IUPAC name is 2-methyl-3-(oxiran-2-ylmethoxy)-2-(oxiran-2-ylmethoxymethyl)propanoic acid.
| Compound Name | 2-methyl-3-(oxiran-2-ylmethoxy)-2-(oxiran-2-ylmethoxymethyl)propanoic acid |
|---|---|
| PubChem CID | 142337917 |
| Molecular Formula | C11H18O6 |
| Molecular Weight | 246.26 g/mol |
| Exact Mass | 246.11 |
| IUPAC Name | 2-methyl-3-(oxiran-2-ylmethoxy)-2-(oxiran-2-ylmethoxymethyl)propanoic acid |
| SMILES | CC(COCC1CO1)(COCC1CO1)C(=O)O |
| InChI | InChI=1S/C11H18O6/c1-11(10(12)13,6-14-2-8-4-16-8)7-15-3-9-5-17-9/h8-9H,2-7H2,1H3,(H,12,13) |
| InChIKey | TXOWZRBCLZUVNL-UHFFFAOYSA-N |
| XLogP | -0.09 |
| TPSA | 80.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.26 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|