C12H16F8O3 — CID 139989468
6,6,7,7,8,8,9,9-octafluoro-1-(oxiran-2-ylmethoxy)nonan-2-ol (PubChem CID 139989468) has the molecular formula C12H16F8O3 and a molecular weight of 360.24 g/mol. Its IUPAC name is 6,6,7,7,8,8,9,9-octafluoro-1-(oxiran-2-ylmethoxy)nonan-2-ol.
| Compound Name | 6,6,7,7,8,8,9,9-octafluoro-1-(oxiran-2-ylmethoxy)nonan-2-ol |
|---|---|
| PubChem CID | 139989468 |
| Molecular Formula | C12H16F8O3 |
| Molecular Weight | 360.24 g/mol |
| Exact Mass | 360.10 |
| IUPAC Name | 6,6,7,7,8,8,9,9-octafluoro-1-(oxiran-2-ylmethoxy)nonan-2-ol |
| SMILES | OC(CCCC(F)(F)C(F)(F)C(F)(F)C(F)F)COCC1CO1 |
| InChI | InChI=1S/C12H16F8O3/c13-9(14)11(17,18)12(19,20)10(15,16)3-1-2-7(21)4-22-5-8-6-23-8/h7-9,21H,1-6H2 |
| InChIKey | LFWOCZCFMIZCJK-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.24 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|