C19H20F16O5 — CID 139989518
2-[[1-(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10-hexadecafluorodecoxy)-3-(oxiran-2-ylmethoxy)propan-2-yl]oxymethyl]oxirane (PubChem CID 139989518) has the molecular formula C19H20F16O5 and a molecular weight of 632.33 g/mol. Its IUPAC name is 2-[[1-(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10-hexadecafluorodecoxy)-3-(oxiran-2-ylmethoxy)propan-2-yl]oxymethyl]oxirane.
| Compound Name | 2-[[1-(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10-hexadecafluorodecoxy)-3-(oxiran-2-ylmethoxy)propan-2-yl]oxymethyl]oxirane |
|---|---|
| PubChem CID | 139989518 |
| Molecular Formula | C19H20F16O5 |
| Molecular Weight | 632.33 g/mol |
| Exact Mass | 632.11 |
| IUPAC Name | 2-[[1-(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10-hexadecafluorodecoxy)-3-(oxiran-2-ylmethoxy)propan-2-yl]oxymethyl]oxirane |
| SMILES | FC(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)CCOCC(COCC1CO1)OCC1CO1 |
| InChI | InChI=1S/C19H20F16O5/c20-12(21)14(24,25)16(28,29)18(32,33)19(34,35)17(30,31)15(26,27)13(22,23)1-2-36-3-9(38-7-11-8-40-11)4-37-5-10-6-39-10/h9-12H,1-8H2 |
| InChIKey | PNOSMSDRXZTBRJ-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 52.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.33 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|