C11H17F3O4 — CID 139989516
2-[[5,5,5-trifluoro-1-(oxiran-2-ylmethoxy)pentan-2-yl]oxymethyl]oxirane (PubChem CID 139989516) has the molecular formula C11H17F3O4 and a molecular weight of 270.25 g/mol. Its IUPAC name is 2-[[5,5,5-trifluoro-1-(oxiran-2-ylmethoxy)pentan-2-yl]oxymethyl]oxirane.
| Compound Name | 2-[[5,5,5-trifluoro-1-(oxiran-2-ylmethoxy)pentan-2-yl]oxymethyl]oxirane |
|---|---|
| PubChem CID | 139989516 |
| Molecular Formula | C11H17F3O4 |
| Molecular Weight | 270.25 g/mol |
| Exact Mass | 270.11 |
| IUPAC Name | 2-[[5,5,5-trifluoro-1-(oxiran-2-ylmethoxy)pentan-2-yl]oxymethyl]oxirane |
| SMILES | FC(F)(F)CCC(COCC1CO1)OCC1CO1 |
| InChI | InChI=1S/C11H17F3O4/c12-11(13,14)2-1-8(16-6-10-7-18-10)3-15-4-9-5-17-9/h8-10H,1-7H2 |
| InChIKey | PRTZAKHERRMVFU-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 43.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.25 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|