C12H20FNO5S — CID 146374244
[5,6-bis(oxiran-2-ylmethoxy)hexanoylamino] thiohypofluorite (PubChem CID 146374244) has the molecular formula C12H20FNO5S and a molecular weight of 309.36 g/mol. Its IUPAC name is [5,6-bis(oxiran-2-ylmethoxy)hexanoylamino] thiohypofluorite.
| Compound Name | [5,6-bis(oxiran-2-ylmethoxy)hexanoylamino] thiohypofluorite |
|---|---|
| PubChem CID | 146374244 |
| Molecular Formula | C12H20FNO5S |
| Molecular Weight | 309.36 g/mol |
| Exact Mass | 309.10 |
| IUPAC Name | [5,6-bis(oxiran-2-ylmethoxy)hexanoylamino] thiohypofluorite |
| SMILES | O=C(CCCC(COCC1CO1)OCC1CO1)NSF |
| InChI | InChI=1S/C12H20FNO5S/c13-20-14-12(15)3-1-2-9(17-7-11-8-19-11)4-16-5-10-6-18-10/h9-11H,1-8H2,(H,14,15) |
| InChIKey | CPUUEBHWXALCQJ-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 72.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.36 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|