C18H34O9 — CID 160886670
2-[1,3-bis(oxiran-2-ylmethoxy)propan-2-yloxymethyl]oxirane;2-ethyl-2-(hydroxymethyl)propane-1,3-diol (PubChem CID 160886670) has the molecular formula C18H34O9 and a molecular weight of 394.46 g/mol. Its IUPAC name is 2-[1,3-bis(oxiran-2-ylmethoxy)propan-2-yloxymethyl]oxirane;2-ethyl-2-(hydroxymethyl)propane-1,3-diol.
| Compound Name | 2-[1,3-bis(oxiran-2-ylmethoxy)propan-2-yloxymethyl]oxirane;2-ethyl-2-(hydroxymethyl)propane-1,3-diol |
|---|---|
| PubChem CID | 160886670 |
| Molecular Formula | C18H34O9 |
| Molecular Weight | 394.46 g/mol |
| Exact Mass | 394.22 |
| IUPAC Name | 2-[1,3-bis(oxiran-2-ylmethoxy)propan-2-yloxymethyl]oxirane;2-ethyl-2-(hydroxymethyl)propane-1,3-diol |
| SMILES | C(OCC1CO1)C(COCC1CO1)OCC1CO1.CCC(CO)(CO)CO |
| InChI | InChI=1S/C12H20O6.C6H14O3/c1(13-3-10-5-16-10)9(15-7-12-8-18-12)2-14-4-11-6-17-11;1-2-6(3-7,4-8)5-9/h9-12H,1-8H2;7-9H,2-5H2,1H3 |
| InChIKey | SNSNMSDWMHVRIW-UHFFFAOYSA-N |
| XLogP | -1.04 |
| TPSA | 125.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.46 |
| LogP ≤ 5 | -1.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|