C14H18F8O5 — CID 139989576
2-[[1-(2,2,3,3,4,4,5,5-octafluoropentoxy)-3-(oxiran-2-ylmethoxy)propan-2-yl]oxymethyl]oxirane (PubChem CID 139989576) has the molecular formula C14H18F8O5 and a molecular weight of 418.28 g/mol. Its IUPAC name is 2-[[1-(2,2,3,3,4,4,5,5-octafluoropentoxy)-3-(oxiran-2-ylmethoxy)propan-2-yl]oxymethyl]oxirane.
| Compound Name | 2-[[1-(2,2,3,3,4,4,5,5-octafluoropentoxy)-3-(oxiran-2-ylmethoxy)propan-2-yl]oxymethyl]oxirane |
|---|---|
| PubChem CID | 139989576 |
| Molecular Formula | C14H18F8O5 |
| Molecular Weight | 418.28 g/mol |
| Exact Mass | 418.10 |
| IUPAC Name | 2-[[1-(2,2,3,3,4,4,5,5-octafluoropentoxy)-3-(oxiran-2-ylmethoxy)propan-2-yl]oxymethyl]oxirane |
| SMILES | FC(F)C(F)(F)C(F)(F)C(F)(F)COCC(COCC1CO1)OCC1CO1 |
| InChI | InChI=1S/C14H18F8O5/c15-11(16)13(19,20)14(21,22)12(17,18)7-24-3-8(25-5-10-6-27-10)1-23-2-9-4-26-9/h8-11H,1-7H2 |
| InChIKey | JZGRHVJLVONLTA-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 52.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.28 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|