C20H16F24O4 — CID 139989574
2-(oxiran-2-ylmethoxy)-3-(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13,14,14-tetracosafluorotetradecoxy)propan-1-ol (PubChem CID 139989574) has the molecular formula C20H16F24O4 and a molecular weight of 776.30 g/mol. Its IUPAC name is 2-(oxiran-2-ylmethoxy)-3-(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13,14,14-tetracosafluorotetradecoxy)propan-1-ol.
| Compound Name | 2-(oxiran-2-ylmethoxy)-3-(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13,14,14-tetracosafluorotetradecoxy)propan-1-ol |
|---|---|
| PubChem CID | 139989574 |
| Molecular Formula | C20H16F24O4 |
| Molecular Weight | 776.30 g/mol |
| Exact Mass | 776.07 |
| IUPAC Name | 2-(oxiran-2-ylmethoxy)-3-(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13,14,14-tetracosafluorotetradecoxy)propan-1-ol |
| SMILES | OCC(COCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)F)OCC1CO1 |
| InChI | InChI=1S/C20H16F24O4/c21-9(22)11(25,26)13(29,30)15(33,34)17(37,38)19(41,42)20(43,44)18(39,40)16(35,36)14(31,32)12(27,28)10(23,24)1-2-46-4-7(3-45)47-5-8-6-48-8/h7-9,45H,1-6H2 |
| InChIKey | VQIURBUJMNRODF-UHFFFAOYSA-N |
| XLogP | 7.42 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 776.30 |
| LogP ≤ 5 | 7.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|