C20H29F9O5S — CID 154967503
2-[[1-[3-(3,3,4,4,5,5,6,6,6-nonafluorohexylsulfanyl)propoxy]-3-[2-(oxiran-2-yl)ethoxy]propan-2-yl]oxymethyl]oxetane (PubChem CID 154967503) has the molecular formula C20H29F9O5S and a molecular weight of 552.50 g/mol. Its IUPAC name is 2-[[1-[3-(3,3,4,4,5,5,6,6,6-nonafluorohexylsulfanyl)propoxy]-3-[2-(oxiran-2-yl)ethoxy]propan-2-yl]oxymethyl]oxetane.
| Compound Name | 2-[[1-[3-(3,3,4,4,5,5,6,6,6-nonafluorohexylsulfanyl)propoxy]-3-[2-(oxiran-2-yl)ethoxy]propan-2-yl]oxymethyl]oxetane |
|---|---|
| PubChem CID | 154967503 |
| Molecular Formula | C20H29F9O5S |
| Molecular Weight | 552.50 g/mol |
| Exact Mass | 552.16 |
| IUPAC Name | 2-[[1-[3-(3,3,4,4,5,5,6,6,6-nonafluorohexylsulfanyl)propoxy]-3-[2-(oxiran-2-yl)ethoxy]propan-2-yl]oxymethyl]oxetane |
| SMILES | FC(F)(F)C(F)(F)C(F)(F)C(F)(F)CCSCCCOCC(COCCC1CO1)OCC1CCO1 |
| InChI | InChI=1S/C20H29F9O5S/c21-17(22,18(23,24)19(25,26)20(27,28)29)4-9-35-8-1-5-30-10-16(34-12-14-3-7-32-14)11-31-6-2-15-13-33-15/h14-16H,1-13H2 |
| InChIKey | DLROWVFLBRMPIH-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 49.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.50 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|